About 1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol
1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol (PubChem CID 80605106) has the molecular formula C9H13ClF2N2O
and a molecular weight of 238.67 g/mol. Its IUPAC name is 1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol.
Molecular Properties
| Compound Name | 1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol |
| PubChem CID | 80605106 |
| Molecular Formula | C9H13ClF2N2O |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol |
| SMILES | CC(C)c1nn(C)c(Cl)c1C(O)C(F)F |
| InChI | InChI=1S/C9H13ClF2N2O/c1-4(2)6-5(7(15)9(11)12)8(10)14(3)13-6/h4,7,9,15H,1-3H3 |
| InChIKey | CHAHGKNRVNLBDM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol?
The IUPAC name of 1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol (CID 80605106) is 1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol.
What is the SMILES notation for 1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol?
The canonical SMILES for 1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol is CC(C)c1nn(C)c(Cl)c1C(O)C(F)F.
What is the InChIKey of 1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol?
The InChIKey is CHAHGKNRVNLBDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClF2N2O/c1-4(2)6-5(7(15)9(11)12)8(10)14(3)13-6/h4,7,9,15H,1-3H3.
What are the key properties of 1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol?
1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol has a molecular weight of 238.67 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)-2,2-difluoroethanol is sourced from PubChem (CID 80605106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).