C10H12F3N — CID 80605462
N-ethyl-2,2-difluoro-1-(3-fluorophenyl)ethanamine (PubChem CID 80605462) has the molecular formula C10H12F3N and a molecular weight of 203.21 g/mol. Its IUPAC name is N-ethyl-2,2-difluoro-1-(3-fluorophenyl)ethanamine.
| Compound Name | N-ethyl-2,2-difluoro-1-(3-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 80605462 |
| Molecular Formula | C10H12F3N |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | N-ethyl-2,2-difluoro-1-(3-fluorophenyl)ethanamine |
| SMILES | CCNC(c1cccc(F)c1)C(F)F |
| InChI | InChI=1S/C10H12F3N/c1-2-14-9(10(12)13)7-4-3-5-8(11)6-7/h3-6,9-10,14H,2H2,1H3 |
| InChIKey | ZOCGRPNDLUGLCN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |