About N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine
N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine (PubChem CID 80605539) has the molecular formula C9H15F2N3
and a molecular weight of 203.24 g/mol. Its IUPAC name is N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine |
| PubChem CID | 80605539 |
| Molecular Formula | C9H15F2N3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(c1cncn1C)C(F)F |
| InChI | InChI=1S/C9H15F2N3/c1-3-4-13-8(9(10)11)7-5-12-6-14(7)2/h5-6,8-9,13H,3-4H2,1-2H3 |
| InChIKey | QOSUGOSHLUXDMQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine?
The IUPAC name of N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine (CID 80605539) is N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine.
What is the SMILES notation for N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine?
The canonical SMILES for N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine is CCCNC(c1cncn1C)C(F)F.
What is the InChIKey of N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine?
The InChIKey is QOSUGOSHLUXDMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2N3/c1-3-4-13-8(9(10)11)7-5-12-6-14(7)2/h5-6,8-9,13H,3-4H2,1-2H3.
What are the key properties of N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine?
N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine has a molecular weight of 203.24 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2-difluoro-1-(3-methylimidazol-4-yl)ethyl]propan-1-amine is sourced from PubChem (CID 80605539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).