About (Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine
(Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine (PubChem CID 80605900) has the molecular formula C9H17F2NO
and a molecular weight of 193.24 g/mol. Its IUPAC name is (Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine.
Molecular Properties
| Compound Name | (Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine |
| PubChem CID | 80605900 |
| Molecular Formula | C9H17F2NO |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine |
| SMILES | COCCNCC/C=C(/C)C(F)F |
| InChI | InChI=1S/C9H17F2NO/c1-8(9(10)11)4-3-5-12-6-7-13-2/h4,9,12H,3,5-7H2,1-2H3/b8-4- |
| InChIKey | QPVSMIKYOHFRHH-YWEYNIOJSA-N |
| XLogP | 1.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine?
The IUPAC name of (Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine (CID 80605900) is (Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine.
What is the SMILES notation for (Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine?
The canonical SMILES for (Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine is COCCNCC/C=C(/C)C(F)F.
What is the InChIKey of (Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine?
The InChIKey is QPVSMIKYOHFRHH-YWEYNIOJSA-N. The full InChI is InChI=1S/C9H17F2NO/c1-8(9(10)11)4-3-5-12-6-7-13-2/h4,9,12H,3,5-7H2,1-2H3/b8-4-.
What are the key properties of (Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine?
(Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine has a molecular weight of 193.24 g/mol, XLogP of 1.82, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5,5-difluoro-N-(2-methoxyethyl)-4-methylpent-3-en-1-amine is sourced from PubChem (CID 80605900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).