About 1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol
1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol (PubChem CID 80605931) has the molecular formula C8H10F2N2O
and a molecular weight of 188.18 g/mol. Its IUPAC name is 1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol.
Molecular Properties
| Compound Name | 1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol |
| PubChem CID | 80605931 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol |
| SMILES | OC(c1cncn1C1CC1)C(F)F |
| InChI | InChI=1S/C8H10F2N2O/c9-8(10)7(13)6-3-11-4-12(6)5-1-2-5/h3-5,7-8,13H,1-2H2 |
| InChIKey | PHDNQSFDOMHJMA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol?
The IUPAC name of 1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol (CID 80605931) is 1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol.
What is the SMILES notation for 1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol?
The canonical SMILES for 1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol is OC(c1cncn1C1CC1)C(F)F.
What is the InChIKey of 1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol?
The InChIKey is PHDNQSFDOMHJMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2O/c9-8(10)7(13)6-3-11-4-12(6)5-1-2-5/h3-5,7-8,13H,1-2H2.
What are the key properties of 1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol?
1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol has a molecular weight of 188.18 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-cyclopropylimidazol-4-yl)-2,2-difluoroethanol is sourced from PubChem (CID 80605931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).