About 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide
1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide (PubChem CID 80606198) has the molecular formula C10H17N5OS
and a molecular weight of 255.35 g/mol. Its IUPAC name is 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide.
Molecular Properties
| Compound Name | 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide |
| PubChem CID | 80606198 |
| Molecular Formula | C10H17N5OS |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCCN1Cc1nnc(N)s1 |
| InChI | InChI=1S/C10H17N5OS/c1-12-9(16)7-4-2-3-5-15(7)6-8-13-14-10(11)17-8/h7H,2-6H2,1H3,(H2,11,14)(H,12,16) |
| InChIKey | FEAQAXIMTKNYIE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide?
The IUPAC name of 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide (CID 80606198) is 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide.
What is the SMILES notation for 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide?
The canonical SMILES for 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide is CNC(=O)C1CCCCN1Cc1nnc(N)s1.
What is the InChIKey of 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide?
The InChIKey is FEAQAXIMTKNYIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5OS/c1-12-9(16)7-4-2-3-5-15(7)6-8-13-14-10(11)17-8/h7H,2-6H2,1H3,(H2,11,14)(H,12,16).
What are the key properties of 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide?
1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide has a molecular weight of 255.35 g/mol, XLogP of 0.22, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-N-methylpiperidine-2-carboxamide is sourced from PubChem (CID 80606198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).