About 2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine
2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine (PubChem CID 80606250) has the molecular formula C10H17ClN4S
and a molecular weight of 260.79 g/mol. Its IUPAC name is 2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine |
| PubChem CID | 80606250 |
| Molecular Formula | C10H17ClN4S |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine |
| SMILES | NCCC1CCN(Cc2nnc(Cl)s2)CC1 |
| InChI | InChI=1S/C10H17ClN4S/c11-10-14-13-9(16-10)7-15-5-2-8(1-4-12)3-6-15/h8H,1-7,12H2 |
| InChIKey | LRLUANLBNNGLCQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine?
The IUPAC name of 2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine (CID 80606250) is 2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine.
What is the SMILES notation for 2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine?
The canonical SMILES for 2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine is NCCC1CCN(Cc2nnc(Cl)s2)CC1.
What is the InChIKey of 2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine?
The InChIKey is LRLUANLBNNGLCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17ClN4S/c11-10-14-13-9(16-10)7-15-5-2-8(1-4-12)3-6-15/h8H,1-7,12H2.
What are the key properties of 2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine?
2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine has a molecular weight of 260.79 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]piperidin-4-yl]ethanamine is sourced from PubChem (CID 80606250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).