About [1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol
[1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol (PubChem CID 80606257) has the molecular formula C11H20N4OS
and a molecular weight of 256.37 g/mol. Its IUPAC name is [1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol |
| PubChem CID | 80606257 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | [1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol |
| SMILES | CCNc1nnc(CN2CCC(CO)CC2)s1 |
| InChI | InChI=1S/C11H20N4OS/c1-2-12-11-14-13-10(17-11)7-15-5-3-9(8-16)4-6-15/h9,16H,2-8H2,1H3,(H,12,14) |
| InChIKey | VOUCEOZSQIBMSK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol?
The IUPAC name of [1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol (CID 80606257) is [1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol.
What is the SMILES notation for [1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol?
The canonical SMILES for [1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol is CCNc1nnc(CN2CCC(CO)CC2)s1.
What is the InChIKey of [1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol?
The InChIKey is VOUCEOZSQIBMSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4OS/c1-2-12-11-14-13-10(17-11)7-15-5-3-9(8-16)4-6-15/h9,16H,2-8H2,1H3,(H,12,14).
What are the key properties of [1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol?
[1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol has a molecular weight of 256.37 g/mol, XLogP of 1.17, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]piperidin-4-yl]methanol is sourced from PubChem (CID 80606257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).