About 1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide
1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide (PubChem CID 80606498) has the molecular formula C12H21N5OS
and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide.
Molecular Properties
| Compound Name | 1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide |
| PubChem CID | 80606498 |
| Molecular Formula | C12H21N5OS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide |
| SMILES | CCNc1nnc(CN2CCCCC2C(=O)NC)s1 |
| InChI | InChI=1S/C12H21N5OS/c1-3-14-12-16-15-10(19-12)8-17-7-5-4-6-9(17)11(18)13-2/h9H,3-8H2,1-2H3,(H,13,18)(H,14,16) |
| InChIKey | VBZPYSXHKJOMJY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide?
The IUPAC name of 1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide (CID 80606498) is 1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide.
What is the SMILES notation for 1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide?
The canonical SMILES for 1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide is CCNc1nnc(CN2CCCCC2C(=O)NC)s1.
What is the InChIKey of 1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide?
The InChIKey is VBZPYSXHKJOMJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5OS/c1-3-14-12-16-15-10(19-12)8-17-7-5-4-6-9(17)11(18)13-2/h9H,3-8H2,1-2H3,(H,13,18)(H,14,16).
What are the key properties of 1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide?
1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide has a molecular weight of 283.40 g/mol, XLogP of 1.07, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-N-methylpiperidine-2-carboxamide is sourced from PubChem (CID 80606498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).