About 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide
2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 80606499) has the molecular formula C11H21N5O2S
and a molecular weight of 287.39 g/mol. Its IUPAC name is 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide |
| PubChem CID | 80606499 |
| Molecular Formula | C11H21N5O2S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCNc1nnc(CN(C)CC(=O)NCCOC)s1 |
| InChI | InChI=1S/C11H21N5O2S/c1-4-12-11-15-14-10(19-11)8-16(2)7-9(17)13-5-6-18-3/h4-8H2,1-3H3,(H,12,15)(H,13,17) |
| InChIKey | GMZPYLZCHFWEQX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide?
The IUPAC name of 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide (CID 80606499) is 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide.
What is the SMILES notation for 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide?
The canonical SMILES for 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide is CCNc1nnc(CN(C)CC(=O)NCCOC)s1.
What is the InChIKey of 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide?
The InChIKey is GMZPYLZCHFWEQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N5O2S/c1-4-12-11-15-14-10(19-11)8-16(2)7-9(17)13-5-6-18-3/h4-8H2,1-3H3,(H,12,15)(H,13,17).
What are the key properties of 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide?
2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide has a molecular weight of 287.39 g/mol, XLogP of 0.16, 9 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl-methylamino]-N-(2-methoxyethyl)acetamide is sourced from PubChem (CID 80606499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).