About 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine
2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine (PubChem CID 80607284) has the molecular formula C9H16ClN3S2
and a molecular weight of 265.83 g/mol. Its IUPAC name is 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine |
| PubChem CID | 80607284 |
| Molecular Formula | C9H16ClN3S2 |
| Molecular Weight | 265.83 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCSCc1nnc(Cl)s1 |
| InChI | InChI=1S/C9H16ClN3S2/c1-3-13(4-2)5-6-14-7-8-11-12-9(10)15-8/h3-7H2,1-2H3 |
| InChIKey | BNWDNPRVQQQKFR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine?
The IUPAC name of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine (CID 80607284) is 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine.
What is the SMILES notation for 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine?
The canonical SMILES for 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine is CCN(CC)CCSCc1nnc(Cl)s1.
What is the InChIKey of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine?
The InChIKey is BNWDNPRVQQQKFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClN3S2/c1-3-13(4-2)5-6-14-7-8-11-12-9(10)15-8/h3-7H2,1-2H3.
What are the key properties of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine?
2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine has a molecular weight of 265.83 g/mol, XLogP of 2.77, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methylsulfanyl]-N,N-diethylethanamine is sourced from PubChem (CID 80607284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).