About 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one
1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 80608106) has the molecular formula C10H9F3N4OS
and a molecular weight of 290.27 g/mol. Its IUPAC name is 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 80608106 |
| Molecular Formula | C10H9F3N4OS |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CNc1nnc(Cn2cc(C(F)(F)F)ccc2=O)s1 |
| InChI | InChI=1S/C10H9F3N4OS/c1-14-9-16-15-7(19-9)5-17-4-6(10(11,12)13)2-3-8(17)18/h2-4H,5H2,1H3,(H,14,16) |
| InChIKey | SSXLWKKEHUSYSH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one (CID 80608106) is 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one is CNc1nnc(Cn2cc(C(F)(F)F)ccc2=O)s1.
What is the InChIKey of 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one?
The InChIKey is SSXLWKKEHUSYSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N4OS/c1-14-9-16-15-7(19-9)5-17-4-6(10(11,12)13)2-3-8(17)18/h2-4H,5H2,1H3,(H,14,16).
What are the key properties of 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one?
1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one has a molecular weight of 290.27 g/mol, XLogP of 1.81, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 80608106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).