C9H10IN5OS — CID 80608115
5-iodo-2-methyl-3-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]pyrimidin-4-one (PubChem CID 80608115) has the molecular formula C9H10IN5OS and a molecular weight of 363.18 g/mol. Its IUPAC name is 5-iodo-2-methyl-3-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]pyrimidin-4-one.
| Compound Name | 5-iodo-2-methyl-3-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 80608115 |
| Molecular Formula | C9H10IN5OS |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 5-iodo-2-methyl-3-[[5-(methylamino)-1,3,4-thiadiazol-2-yl]methyl]pyrimidin-4-one |
| SMILES | CNc1nnc(Cn2c(C)ncc(I)c2=O)s1 |
| InChI | InChI=1S/C9H10IN5OS/c1-5-12-3-6(10)8(16)15(5)4-7-13-14-9(11-2)17-7/h3H,4H2,1-2H3,(H,11,14) |
| InChIKey | IQKPOUUAABJUAO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|