About 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one
3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one (PubChem CID 80608294) has the molecular formula C10H12IN5OS
and a molecular weight of 377.21 g/mol. Its IUPAC name is 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one |
| PubChem CID | 80608294 |
| Molecular Formula | C10H12IN5OS |
| Molecular Weight | 377.21 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one |
| SMILES | CCNc1nnc(Cn2c(C)ncc(I)c2=O)s1 |
| InChI | InChI=1S/C10H12IN5OS/c1-3-12-10-15-14-8(18-10)5-16-6(2)13-4-7(11)9(16)17/h4H,3,5H2,1-2H3,(H,12,15) |
| InChIKey | YYYLXICDXKNFHG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one?
The IUPAC name of 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one (CID 80608294) is 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one.
What is the SMILES notation for 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one?
The canonical SMILES for 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one is CCNc1nnc(Cn2c(C)ncc(I)c2=O)s1.
What is the InChIKey of 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one?
The InChIKey is YYYLXICDXKNFHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12IN5OS/c1-3-12-10-15-14-8(18-10)5-16-6(2)13-4-7(11)9(16)17/h4H,3,5H2,1-2H3,(H,12,15).
What are the key properties of 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one?
3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one has a molecular weight of 377.21 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methyl]-5-iodo-2-methylpyrimidin-4-one is sourced from PubChem (CID 80608294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).