About 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one
3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one (PubChem CID 80608725) has the molecular formula C8H9N5OS
and a molecular weight of 223.26 g/mol. Its IUPAC name is 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one |
| PubChem CID | 80608725 |
| Molecular Formula | C8H9N5OS |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(Cc2nnc(N)s2)cn1 |
| InChI | InChI=1S/C8H9N5OS/c1-5-2-7(14)13(4-10-5)3-6-11-12-8(9)15-6/h2,4H,3H2,1H3,(H2,9,12) |
| InChIKey | UPUKBMLIZBYGEF-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one?
The IUPAC name of 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one (CID 80608725) is 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one.
What is the SMILES notation for 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one?
The canonical SMILES for 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one is Cc1cc(=O)n(Cc2nnc(N)s2)cn1.
What is the InChIKey of 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one?
The InChIKey is UPUKBMLIZBYGEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5OS/c1-5-2-7(14)13(4-10-5)3-6-11-12-8(9)15-6/h2,4H,3H2,1H3,(H2,9,12).
What are the key properties of 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one?
3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one has a molecular weight of 223.26 g/mol, XLogP of 0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-methylpyrimidin-4-one is sourced from PubChem (CID 80608725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).