C12H21N5S — CID 80609055
5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine (PubChem CID 80609055) has the molecular formula C12H21N5S and a molecular weight of 267.40 g/mol. Its IUPAC name is 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80609055 |
| Molecular Formula | C12H21N5S |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-N-ethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCNc1nnc(CN2CCN3CCCC3C2)s1 |
| InChI | InChI=1S/C12H21N5S/c1-2-13-12-15-14-11(18-12)9-16-6-7-17-5-3-4-10(17)8-16/h10H,2-9H2,1H3,(H,13,15) |
| InChIKey | TUNIRPRKIRFODJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |