About 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one
1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one (PubChem CID 80609204) has the molecular formula C9H12ClN3OS
and a molecular weight of 245.73 g/mol. Its IUPAC name is 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one.
Molecular Properties
| Compound Name | 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one |
| PubChem CID | 80609204 |
| Molecular Formula | C9H12ClN3OS |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one |
| SMILES | O=C1CCCCCN1Cc1nnc(Cl)s1 |
| InChI | InChI=1S/C9H12ClN3OS/c10-9-12-11-7(15-9)6-13-5-3-1-2-4-8(13)14/h1-6H2 |
| InChIKey | LXCFYORRKMPLPG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one?
The IUPAC name of 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one (CID 80609204) is 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one.
What is the SMILES notation for 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one?
The canonical SMILES for 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one is O=C1CCCCCN1Cc1nnc(Cl)s1.
What is the InChIKey of 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one?
The InChIKey is LXCFYORRKMPLPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClN3OS/c10-9-12-11-7(15-9)6-13-5-3-1-2-4-8(13)14/h1-6H2.
What are the key properties of 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one?
1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one has a molecular weight of 245.73 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]azepan-2-one is sourced from PubChem (CID 80609204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).