C8H6ClN3O2S — CID 80609213
3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 80609213) has the molecular formula C8H6ClN3O2S and a molecular weight of 243.67 g/mol. Its IUPAC name is 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 80609213 |
| Molecular Formula | C8H6ClN3O2S |
| Molecular Weight | 243.67 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | O=C1C2CC2C(=O)N1Cc1nnc(Cl)s1 |
| InChI | InChI=1S/C8H6ClN3O2S/c9-8-11-10-5(15-8)2-12-6(13)3-1-4(3)7(12)14/h3-4H,1-2H2 |
| InChIKey | GGTALVPLEMGZGH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.67 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|