C14H25N3O3S — CID 80609392
3-[4-(thian-2-ylmethylcarbamoyl)piperazin-1-yl]propanoic acid (PubChem CID 80609392) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is 3-[4-(thian-2-ylmethylcarbamoyl)piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-(thian-2-ylmethylcarbamoyl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 80609392 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-[4-(thian-2-ylmethylcarbamoyl)piperazin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCN(C(=O)NCC2CCCCS2)CC1 |
| InChI | InChI=1S/C14H25N3O3S/c18-13(19)4-5-16-6-8-17(9-7-16)14(20)15-11-12-3-1-2-10-21-12/h12H,1-11H2,(H,15,20)(H,18,19) |
| InChIKey | DRAOBTMOMDKGEM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |