About 2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole
2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole (PubChem CID 80609538) has the molecular formula C12H20ClN3S
and a molecular weight of 273.83 g/mol. Its IUPAC name is 2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole |
| PubChem CID | 80609538 |
| Molecular Formula | C12H20ClN3S |
| Molecular Weight | 273.83 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole |
| SMILES | CCC1(CC)CCN(Cc2nnc(Cl)s2)CC1 |
| InChI | InChI=1S/C12H20ClN3S/c1-3-12(4-2)5-7-16(8-6-12)9-10-14-15-11(13)17-10/h3-9H2,1-2H3 |
| InChIKey | ACDGJYROXXJRQP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.83 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole?
The IUPAC name of 2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole (CID 80609538) is 2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole.
What is the SMILES notation for 2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole?
The canonical SMILES for 2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole is CCC1(CC)CCN(Cc2nnc(Cl)s2)CC1.
What is the InChIKey of 2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole?
The InChIKey is ACDGJYROXXJRQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20ClN3S/c1-3-12(4-2)5-7-16(8-6-12)9-10-14-15-11(13)17-10/h3-9H2,1-2H3.
What are the key properties of 2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole?
2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole has a molecular weight of 273.83 g/mol, XLogP of 3.59, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[(4,4-diethylpiperidin-1-yl)methyl]-1,3,4-thiadiazole is sourced from PubChem (CID 80609538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).