C11H13ClN4O2S — CID 80609773
3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 80609773) has the molecular formula C11H13ClN4O2S and a molecular weight of 300.77 g/mol. Its IUPAC name is 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 80609773 |
| Molecular Formula | C11H13ClN4O2S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCCCC2)C(=O)N1Cc1nnc(Cl)s1 |
| InChI | InChI=1S/C11H13ClN4O2S/c12-9-15-14-7(19-9)6-16-8(17)11(13-10(16)18)4-2-1-3-5-11/h1-6H2,(H,13,18) |
| InChIKey | BBIDOUILRKUGAM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|