C15H24N2S — CID 80610124
2-cyclooctyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine (PubChem CID 80610124) has the molecular formula C15H24N2S and a molecular weight of 264.44 g/mol. Its IUPAC name is 2-cyclooctyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine.
| Compound Name | 2-cyclooctyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 80610124 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-cyclooctyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
| SMILES | NC1CCCc2sc(C3CCCCCCC3)nc21 |
| InChI | InChI=1S/C15H24N2S/c16-12-9-6-10-13-14(12)17-15(18-13)11-7-4-2-1-3-5-8-11/h11-12H,1-10,16H2 |
| InChIKey | OJAMIEYTWNGWJV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |