About 6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one
6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one (PubChem CID 80610232) has the molecular formula C11H7Cl2N3OS
and a molecular weight of 300.17 g/mol. Its IUPAC name is 6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one.
Molecular Properties
| Compound Name | 6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one |
| PubChem CID | 80610232 |
| Molecular Formula | C11H7Cl2N3OS |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | 6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one |
| SMILES | O=C1Cc2ccc(Cl)cc2N1Cc1nnc(Cl)s1 |
| InChI | InChI=1S/C11H7Cl2N3OS/c12-7-2-1-6-3-10(17)16(8(6)4-7)5-9-14-15-11(13)18-9/h1-2,4H,3,5H2 |
| InChIKey | IRXBKSSUDQGNGH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one?
The IUPAC name of 6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one (CID 80610232) is 6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one.
What is the SMILES notation for 6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one?
The canonical SMILES for 6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one is O=C1Cc2ccc(Cl)cc2N1Cc1nnc(Cl)s1.
What is the InChIKey of 6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one?
The InChIKey is IRXBKSSUDQGNGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl2N3OS/c12-7-2-1-6-3-10(17)16(8(6)4-7)5-9-14-15-11(13)18-9/h1-2,4H,3,5H2.
What are the key properties of 6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one?
6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one has a molecular weight of 300.17 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-3H-indol-2-one is sourced from PubChem (CID 80610232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).