About 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one
3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one (PubChem CID 80610474) has the molecular formula C7H4ClIN4OS
and a molecular weight of 354.56 g/mol. Its IUPAC name is 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one |
| PubChem CID | 80610474 |
| Molecular Formula | C7H4ClIN4OS |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 353.88 |
| IUPAC Name | 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one |
| SMILES | O=c1c(I)cncn1Cc1nnc(Cl)s1 |
| InChI | InChI=1S/C7H4ClIN4OS/c8-7-12-11-5(15-7)2-13-3-10-1-4(9)6(13)14/h1,3H,2H2 |
| InChIKey | JIFYVPOFAMDDIY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one?
The IUPAC name of 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one (CID 80610474) is 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one.
What is the SMILES notation for 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one?
The canonical SMILES for 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one is O=c1c(I)cncn1Cc1nnc(Cl)s1.
What is the InChIKey of 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one?
The InChIKey is JIFYVPOFAMDDIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClIN4OS/c8-7-12-11-5(15-7)2-13-3-10-1-4(9)6(13)14/h1,3H,2H2.
What are the key properties of 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one?
3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one has a molecular weight of 354.56 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one is sourced from PubChem (CID 80610474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).