About 1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol
1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol (PubChem CID 80610563) has the molecular formula C19H31NO
and a molecular weight of 289.46 g/mol. Its IUPAC name is 1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol.
Molecular Properties
| Compound Name | 1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol |
| PubChem CID | 80610563 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(C)c(C(C)(O)C2(CN)CCCCCCC2)c1 |
| InChI | InChI=1S/C19H31NO/c1-15-9-10-16(2)17(13-15)18(3,21)19(14-20)11-7-5-4-6-8-12-19/h9-10,13,21H,4-8,11-12,14,20H2,1-3H3 |
| InChIKey | LJECTVSLEMBQQU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol?
The IUPAC name of 1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol (CID 80610563) is 1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol.
What is the SMILES notation for 1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol?
The canonical SMILES for 1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol is Cc1ccc(C)c(C(C)(O)C2(CN)CCCCCCC2)c1.
What is the InChIKey of 1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol?
The InChIKey is LJECTVSLEMBQQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31NO/c1-15-9-10-16(2)17(13-15)18(3,21)19(14-20)11-7-5-4-6-8-12-19/h9-10,13,21H,4-8,11-12,14,20H2,1-3H3.
What are the key properties of 1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol?
1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol has a molecular weight of 289.46 g/mol, XLogP of 4.20, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(aminomethyl)cyclooctyl]-1-(2,5-dimethylphenyl)ethanol is sourced from PubChem (CID 80610563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).