About 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide
2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 80611161) has the molecular formula C9H15ClN4O2S
and a molecular weight of 278.76 g/mol. Its IUPAC name is 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide |
| PubChem CID | 80611161 |
| Molecular Formula | C9H15ClN4O2S |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)Cc1nnc(Cl)s1 |
| InChI | InChI=1S/C9H15ClN4O2S/c1-14(5-7(15)11-3-4-16-2)6-8-12-13-9(10)17-8/h3-6H2,1-2H3,(H,11,15) |
| InChIKey | HGOBLQFYIKHGFD-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide?
The IUPAC name of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide (CID 80611161) is 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide.
What is the SMILES notation for 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide?
The canonical SMILES for 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide is COCCNC(=O)CN(C)Cc1nnc(Cl)s1.
What is the InChIKey of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide?
The InChIKey is HGOBLQFYIKHGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClN4O2S/c1-14(5-7(15)11-3-4-16-2)6-8-12-13-9(10)17-8/h3-6H2,1-2H3,(H,11,15).
What are the key properties of 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide?
2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide has a molecular weight of 278.76 g/mol, XLogP of 0.39, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl-methylamino]-N-(2-methoxyethyl)acetamide is sourced from PubChem (CID 80611161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).