About 1,1-difluoropentan-2-ol
1,1-difluoropentan-2-ol (PubChem CID 80611194) has the molecular formula C5H10F2O
and a molecular weight of 124.13 g/mol. Its IUPAC name is 1,1-difluoropentan-2-ol.
Molecular Properties
| Compound Name | 1,1-difluoropentan-2-ol |
| PubChem CID | 80611194 |
| Molecular Formula | C5H10F2O |
| Molecular Weight | 124.13 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 1,1-difluoropentan-2-ol |
| SMILES | CCCC(O)C(F)F |
| InChI | InChI=1S/C5H10F2O/c1-2-3-4(8)5(6)7/h4-5,8H,2-3H2,1H3 |
| InChIKey | FRFXSOMNVNKYLG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.13 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1-difluoropentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoropentan-2-ol?
The IUPAC name of 1,1-difluoropentan-2-ol (CID 80611194) is 1,1-difluoropentan-2-ol.
What is the SMILES notation for 1,1-difluoropentan-2-ol?
The canonical SMILES for 1,1-difluoropentan-2-ol is CCCC(O)C(F)F.
What is the InChIKey of 1,1-difluoropentan-2-ol?
The InChIKey is FRFXSOMNVNKYLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10F2O/c1-2-3-4(8)5(6)7/h4-5,8H,2-3H2,1H3.
What are the key properties of 1,1-difluoropentan-2-ol?
1,1-difluoropentan-2-ol has a molecular weight of 124.13 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoropentan-2-ol is sourced from PubChem (CID 80611194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).