About 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine
4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine (PubChem CID 80611412) has the molecular formula C7H10ClN3S2
and a molecular weight of 235.76 g/mol. Its IUPAC name is 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine.
Molecular Properties
| Compound Name | 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine |
| PubChem CID | 80611412 |
| Molecular Formula | C7H10ClN3S2 |
| Molecular Weight | 235.76 g/mol |
| Exact Mass | 235.00 |
| IUPAC Name | 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine |
| SMILES | Clc1nnc(CN2CCSCC2)s1 |
| InChI | InChI=1S/C7H10ClN3S2/c8-7-10-9-6(13-7)5-11-1-3-12-4-2-11/h1-5H2 |
| InChIKey | JJUAXUDPWFMFEE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.76 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine?
The IUPAC name of 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine (CID 80611412) is 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine.
What is the SMILES notation for 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine?
The canonical SMILES for 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine is Clc1nnc(CN2CCSCC2)s1.
What is the InChIKey of 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine?
The InChIKey is JJUAXUDPWFMFEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3S2/c8-7-10-9-6(13-7)5-11-1-3-12-4-2-11/h1-5H2.
What are the key properties of 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine?
4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine has a molecular weight of 235.76 g/mol, XLogP of 1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-chloro-1,3,4-thiadiazol-2-yl)methyl]thiomorpholine is sourced from PubChem (CID 80611412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).