C14H25N3 — CID 80611535
N-[(2-cyclooctyl-1H-imidazol-5-yl)methyl]ethanamine (PubChem CID 80611535) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is N-[(2-cyclooctyl-1H-imidazol-5-yl)methyl]ethanamine.
| Compound Name | N-[(2-cyclooctyl-1H-imidazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 80611535 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N-[(2-cyclooctyl-1H-imidazol-5-yl)methyl]ethanamine |
| SMILES | CCNCc1cnc(C2CCCCCCC2)[nH]1 |
| InChI | InChI=1S/C14H25N3/c1-2-15-10-13-11-16-14(17-13)12-8-6-4-3-5-7-9-12/h11-12,15H,2-10H2,1H3,(H,16,17) |
| InChIKey | PTANINSIXSFEAM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |