C17H25N3S — CID 80611910
2-cyclooctyl-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 80611910) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is 2-cyclooctyl-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-cyclooctyl-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80611910 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-cyclooctyl-N,5,6-trimethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CNc1nc(C2CCCCCCC2)nc2sc(C)c(C)c12 |
| InChI | InChI=1S/C17H25N3S/c1-11-12(2)21-17-14(11)16(18-3)19-15(20-17)13-9-7-5-4-6-8-10-13/h13H,4-10H2,1-3H3,(H,18,19,20) |
| InChIKey | IORWXSSOQJIIPT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |