About N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine
N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 80612005) has the molecular formula C8H13N3S2
and a molecular weight of 215.35 g/mol. Its IUPAC name is N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine |
| PubChem CID | 80612005 |
| Molecular Formula | C8H13N3S2 |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | c1nsc(NCC2CCCCS2)n1 |
| InChI | InChI=1S/C8H13N3S2/c1-2-4-12-7(3-1)5-9-8-10-6-11-13-8/h6-7H,1-5H2,(H,9,10,11) |
| InChIKey | HWJFKMQZNJPVAD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine?
The IUPAC name of N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine (CID 80612005) is N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine?
The canonical SMILES for N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine is c1nsc(NCC2CCCCS2)n1.
What is the InChIKey of N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine?
The InChIKey is HWJFKMQZNJPVAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3S2/c1-2-4-12-7(3-1)5-9-8-10-6-11-13-8/h6-7H,1-5H2,(H,9,10,11).
What are the key properties of N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine?
N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine has a molecular weight of 215.35 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(thian-2-ylmethyl)-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 80612005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).