About 11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane
11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane (PubChem CID 80612307) has the molecular formula C16H30N2S
and a molecular weight of 282.50 g/mol. Its IUPAC name is 11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane |
| PubChem CID | 80612307 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane |
| SMILES | C1CCC2(CC1)CN(CC1CCCCS1)CCCN2 |
| InChI | InChI=1S/C16H30N2S/c1-3-8-16(9-4-1)14-18(11-6-10-17-16)13-15-7-2-5-12-19-15/h15,17H,1-14H2 |
| InChIKey | ASELTNAYTNADDR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane?
The IUPAC name of 11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane (CID 80612307) is 11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane.
What is the SMILES notation for 11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane?
The canonical SMILES for 11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane is C1CCC2(CC1)CN(CC1CCCCS1)CCCN2.
What is the InChIKey of 11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane?
The InChIKey is ASELTNAYTNADDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2S/c1-3-8-16(9-4-1)14-18(11-6-10-17-16)13-15-7-2-5-12-19-15/h15,17H,1-14H2.
What are the key properties of 11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane?
11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane has a molecular weight of 282.50 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(thian-2-ylmethyl)-7,11-diazaspiro[5.6]dodecane is sourced from PubChem (CID 80612307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).