C8H14N4S2 — CID 80612388
5-N-(thian-2-ylmethyl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 80612388) has the molecular formula C8H14N4S2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 5-N-(thian-2-ylmethyl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-(thian-2-ylmethyl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 80612388 |
| Molecular Formula | C8H14N4S2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 5-N-(thian-2-ylmethyl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | Nc1nsc(NCC2CCCCS2)n1 |
| InChI | InChI=1S/C8H14N4S2/c9-7-11-8(14-12-7)10-5-6-3-1-2-4-13-6/h6H,1-5H2,(H3,9,10,11,12) |
| InChIKey | PURRCLUIPXVGQB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |