C13H16N4OS2 — CID 80612702
7-amino-N-(thian-2-ylmethyl)thieno[2,3-b]pyrazine-6-carboxamide (PubChem CID 80612702) has the molecular formula C13H16N4OS2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 7-amino-N-(thian-2-ylmethyl)thieno[2,3-b]pyrazine-6-carboxamide.
| Compound Name | 7-amino-N-(thian-2-ylmethyl)thieno[2,3-b]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 80612702 |
| Molecular Formula | C13H16N4OS2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 7-amino-N-(thian-2-ylmethyl)thieno[2,3-b]pyrazine-6-carboxamide |
| SMILES | Nc1c(C(=O)NCC2CCCCS2)sc2nccnc12 |
| InChI | InChI=1S/C13H16N4OS2/c14-9-10-13(16-5-4-15-10)20-11(9)12(18)17-7-8-3-1-2-6-19-8/h4-5,8H,1-3,6-7,14H2,(H,17,18) |
| InChIKey | IPGSYXGNMVNSNK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |