About 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one
4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one (PubChem CID 80613588) has the molecular formula C8H14N6OS
and a molecular weight of 242.31 g/mol. Its IUPAC name is 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one |
| PubChem CID | 80613588 |
| Molecular Formula | C8H14N6OS |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1Cc1nnc(NN)s1 |
| InChI | InChI=1S/C8H14N6OS/c1-5-7(15)10-2-3-14(5)4-6-12-13-8(11-9)16-6/h5H,2-4,9H2,1H3,(H,10,15)(H,11,13) |
| InChIKey | WPLSRPWAXMFPFX-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one?
The IUPAC name of 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one (CID 80613588) is 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one.
What is the SMILES notation for 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one?
The canonical SMILES for 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one is CC1C(=O)NCCN1Cc1nnc(NN)s1.
What is the InChIKey of 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one?
The InChIKey is WPLSRPWAXMFPFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N6OS/c1-5-7(15)10-2-3-14(5)4-6-12-13-8(11-9)16-6/h5H,2-4,9H2,1H3,(H,10,15)(H,11,13).
What are the key properties of 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one?
4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one has a molecular weight of 242.31 g/mol, XLogP of -0.86, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-3-methylpiperazin-2-one is sourced from PubChem (CID 80613588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).