C9H18N6OS — CID 80614280
2-[ethyl-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]amino]-N,N-dimethylacetamide (PubChem CID 80614280) has the molecular formula C9H18N6OS and a molecular weight of 258.35 g/mol. Its IUPAC name is 2-[ethyl-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[ethyl-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 80614280 |
| Molecular Formula | C9H18N6OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2-[ethyl-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]amino]-N,N-dimethylacetamide |
| SMILES | CCN(CC(=O)N(C)C)Cc1nnc(NN)s1 |
| InChI | InChI=1S/C9H18N6OS/c1-4-15(6-8(16)14(2)3)5-7-12-13-9(11-10)17-7/h4-6,10H2,1-3H3,(H,11,13) |
| InChIKey | OSNPDQUGPOAHPS-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|