C7H7FN6O2S — CID 80614306
5-fluoro-1-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidine-2,4-dione (PubChem CID 80614306) has the molecular formula C7H7FN6O2S and a molecular weight of 258.24 g/mol. Its IUPAC name is 5-fluoro-1-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 80614306 |
| Molecular Formula | C7H7FN6O2S |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 5-fluoro-1-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]pyrimidine-2,4-dione |
| SMILES | NNc1nnc(Cn2cc(F)c(=O)[nH]c2=O)s1 |
| InChI | InChI=1S/C7H7FN6O2S/c8-3-1-14(7(16)10-5(3)15)2-4-12-13-6(11-9)17-4/h1H,2,9H2,(H,11,13)(H,10,15,16) |
| InChIKey | MLCLPTVOCNQELI-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|