C8H10F5N3OS — CID 80614343
N-ethyl-5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 80614343) has the molecular formula C8H10F5N3OS and a molecular weight of 291.25 g/mol. Its IUPAC name is N-ethyl-5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-ethyl-5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80614343 |
| Molecular Formula | C8H10F5N3OS |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | N-ethyl-5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCNc1nnc(COCC(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C8H10F5N3OS/c1-2-14-6-16-15-5(18-6)3-17-4-7(9,10)8(11,12)13/h2-4H2,1H3,(H,14,16) |
| InChIKey | WJNMJKLEUBMCSO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|