C7H8F5N3OS — CID 80614444
N-methyl-5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 80614444) has the molecular formula C7H8F5N3OS and a molecular weight of 277.22 g/mol. Its IUPAC name is N-methyl-5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-methyl-5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80614444 |
| Molecular Formula | C7H8F5N3OS |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | N-methyl-5-(2,2,3,3,3-pentafluoropropoxymethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CNc1nnc(COCC(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C7H8F5N3OS/c1-13-5-15-14-4(17-5)2-16-3-6(8,9)7(10,11)12/h2-3H2,1H3,(H,13,15) |
| InChIKey | ILRFGMXJBGHUQR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|