C9H8Cl2N4S2 — CID 80614715
[5-[(2,5-dichlorophenyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 80614715) has the molecular formula C9H8Cl2N4S2 and a molecular weight of 307.23 g/mol. Its IUPAC name is [5-[(2,5-dichlorophenyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-[(2,5-dichlorophenyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 80614715 |
| Molecular Formula | C9H8Cl2N4S2 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | [5-[(2,5-dichlorophenyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | NNc1nnc(CSc2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C9H8Cl2N4S2/c10-5-1-2-6(11)7(3-5)16-4-8-14-15-9(13-12)17-8/h1-3H,4,12H2,(H,13,15) |
| InChIKey | SSMWVMWIMNPPMX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|