C9H17N5OS — CID 80614764
[5-[(2,5-dimethylmorpholin-4-yl)methyl]-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 80614764) has the molecular formula C9H17N5OS and a molecular weight of 243.34 g/mol. Its IUPAC name is [5-[(2,5-dimethylmorpholin-4-yl)methyl]-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-[(2,5-dimethylmorpholin-4-yl)methyl]-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 80614764 |
| Molecular Formula | C9H17N5OS |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | [5-[(2,5-dimethylmorpholin-4-yl)methyl]-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | CC1CN(Cc2nnc(NN)s2)C(C)CO1 |
| InChI | InChI=1S/C9H17N5OS/c1-6-5-15-7(2)3-14(6)4-8-12-13-9(11-10)16-8/h6-7H,3-5,10H2,1-2H3,(H,11,13) |
| InChIKey | HUXCTMQXHKUOAL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|