C11H14N4S2 — CID 80614812
[5-[(3,4-dimethylphenyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine (PubChem CID 80614812) has the molecular formula C11H14N4S2 and a molecular weight of 266.40 g/mol. Its IUPAC name is [5-[(3,4-dimethylphenyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine.
| Compound Name | [5-[(3,4-dimethylphenyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 80614812 |
| Molecular Formula | C11H14N4S2 |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | [5-[(3,4-dimethylphenyl)sulfanylmethyl]-1,3,4-thiadiazol-2-yl]hydrazine |
| SMILES | Cc1ccc(SCc2nnc(NN)s2)cc1C |
| InChI | InChI=1S/C11H14N4S2/c1-7-3-4-9(5-8(7)2)16-6-10-14-15-11(13-12)17-10/h3-5H,6,12H2,1-2H3,(H,13,15) |
| InChIKey | ZPNRKTBNAVIYGE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|