C10H13N7OS — CID 80616769
6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methanone (PubChem CID 80616769) has the molecular formula C10H13N7OS and a molecular weight of 279.33 g/mol. Its IUPAC name is 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methanone.
| Compound Name | 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methanone |
|---|---|
| PubChem CID | 80616769 |
| Molecular Formula | C10H13N7OS |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methanone |
| SMILES | CCNc1nnc(C(=O)N2CCn3cnnc3C2)s1 |
| InChI | InChI=1S/C10H13N7OS/c1-2-11-10-15-14-8(19-10)9(18)16-3-4-17-6-12-13-7(17)5-16/h6H,2-5H2,1H3,(H,11,15) |
| InChIKey | KPAQTEPUYFBZPM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |