C8H11F3N4O2S — CID 80617494
5-(methylamino)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80617494) has the molecular formula C8H11F3N4O2S and a molecular weight of 284.26 g/mol. Its IUPAC name is 5-(methylamino)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-(methylamino)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80617494 |
| Molecular Formula | C8H11F3N4O2S |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 5-(methylamino)-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CNc1nnc(C(=O)NCCOCC(F)(F)F)s1 |
| InChI | InChI=1S/C8H11F3N4O2S/c1-12-7-15-14-6(18-7)5(16)13-2-3-17-4-8(9,10)11/h2-4H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | WNRGPLUYDAYIBC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|