C9H14ClN3O3S — CID 80617697
5-chloro-N-(2,2-diethoxyethyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80617697) has the molecular formula C9H14ClN3O3S and a molecular weight of 279.75 g/mol. Its IUPAC name is 5-chloro-N-(2,2-diethoxyethyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-(2,2-diethoxyethyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80617697 |
| Molecular Formula | C9H14ClN3O3S |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 5-chloro-N-(2,2-diethoxyethyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCOC(CNC(=O)c1nnc(Cl)s1)OCC |
| InChI | InChI=1S/C9H14ClN3O3S/c1-3-15-6(16-4-2)5-11-7(14)8-12-13-9(10)17-8/h6H,3-5H2,1-2H3,(H,11,14) |
| InChIKey | RYKOVYKHUDFRFI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|