About methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate
methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate (PubChem CID 80617827) has the molecular formula C7H8ClN3O3S
and a molecular weight of 249.68 g/mol. Its IUPAC name is methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate.
Molecular Properties
| Compound Name | methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate |
| PubChem CID | 80617827 |
| Molecular Formula | C7H8ClN3O3S |
| Molecular Weight | 249.68 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)c1nnc(Cl)s1 |
| InChI | InChI=1S/C7H8ClN3O3S/c1-3(6(13)14-2)9-4(12)5-10-11-7(8)15-5/h3H,1-2H3,(H,9,12) |
| InChIKey | CSURFJKLPLRDMN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.68 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate?
The IUPAC name of methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate (CID 80617827) is methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate.
What is the SMILES notation for methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate?
The canonical SMILES for methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate is COC(=O)C(C)NC(=O)c1nnc(Cl)s1.
What is the InChIKey of methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate?
The InChIKey is CSURFJKLPLRDMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN3O3S/c1-3(6(13)14-2)9-4(12)5-10-11-7(8)15-5/h3H,1-2H3,(H,9,12).
What are the key properties of methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate?
methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate has a molecular weight of 249.68 g/mol, XLogP of 0.48, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(5-chloro-1,3,4-thiadiazole-2-carbonyl)amino]propanoate is sourced from PubChem (CID 80617827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).