About (5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone
(5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone (PubChem CID 80617850) has the molecular formula C11H16ClN3OS
and a molecular weight of 273.79 g/mol. Its IUPAC name is (5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone.
Molecular Properties
| Compound Name | (5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone |
| PubChem CID | 80617850 |
| Molecular Formula | C11H16ClN3OS |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | (5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone |
| SMILES | CC1(C)CCCN(C(=O)c2nnc(Cl)s2)CC1 |
| InChI | InChI=1S/C11H16ClN3OS/c1-11(2)4-3-6-15(7-5-11)9(16)8-13-14-10(12)17-8/h3-7H2,1-2H3 |
| InChIKey | SRPPDVDQKHPMGG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone?
The IUPAC name of (5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone (CID 80617850) is (5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone.
What is the SMILES notation for (5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone?
The canonical SMILES for (5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone is CC1(C)CCCN(C(=O)c2nnc(Cl)s2)CC1.
What is the InChIKey of (5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone?
The InChIKey is SRPPDVDQKHPMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClN3OS/c1-11(2)4-3-6-15(7-5-11)9(16)8-13-14-10(12)17-8/h3-7H2,1-2H3.
What are the key properties of (5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone?
(5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone has a molecular weight of 273.79 g/mol, XLogP of 2.84, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-1,3,4-thiadiazol-2-yl)-(4,4-dimethylazepan-1-yl)methanone is sourced from PubChem (CID 80617850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).