About 4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile
4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile (PubChem CID 80617856) has the molecular formula C8H7ClN4O2S
and a molecular weight of 258.69 g/mol. Its IUPAC name is 4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile.
Molecular Properties
| Compound Name | 4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile |
| PubChem CID | 80617856 |
| Molecular Formula | C8H7ClN4O2S |
| Molecular Weight | 258.69 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile |
| SMILES | N#CC1CN(C(=O)c2nnc(Cl)s2)CCO1 |
| InChI | InChI=1S/C8H7ClN4O2S/c9-8-12-11-6(16-8)7(14)13-1-2-15-5(3-10)4-13/h5H,1-2,4H2 |
| InChIKey | HWFBWLJODCWPAD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 79.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.69 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile?
The IUPAC name of 4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile (CID 80617856) is 4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile.
What is the SMILES notation for 4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile?
The canonical SMILES for 4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile is N#CC1CN(C(=O)c2nnc(Cl)s2)CCO1.
What is the InChIKey of 4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile?
The InChIKey is HWFBWLJODCWPAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN4O2S/c9-8-12-11-6(16-8)7(14)13-1-2-15-5(3-10)4-13/h5H,1-2,4H2.
What are the key properties of 4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile?
4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile has a molecular weight of 258.69 g/mol, XLogP of 0.56, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chloro-1,3,4-thiadiazole-2-carbonyl)morpholine-2-carbonitrile is sourced from PubChem (CID 80617856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).