C12H11ClN4S — CID 80618393
2-(chloromethyl)-5-(5,6-dimethylbenzimidazol-1-yl)-1,3,4-thiadiazole (PubChem CID 80618393) has the molecular formula C12H11ClN4S and a molecular weight of 278.77 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(5,6-dimethylbenzimidazol-1-yl)-1,3,4-thiadiazole.
| Compound Name | 2-(chloromethyl)-5-(5,6-dimethylbenzimidazol-1-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 80618393 |
| Molecular Formula | C12H11ClN4S |
| Molecular Weight | 278.77 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-(chloromethyl)-5-(5,6-dimethylbenzimidazol-1-yl)-1,3,4-thiadiazole |
| SMILES | Cc1cc2ncn(-c3nnc(CCl)s3)c2cc1C |
| InChI | InChI=1S/C12H11ClN4S/c1-7-3-9-10(4-8(7)2)17(6-14-9)12-16-15-11(5-13)18-12/h3-4,6H,5H2,1-2H3 |
| InChIKey | GOTARYWBMLXEIT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.77 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|