C8H7ClN4O3S — CID 80618531
5-chloro-N-(2,6-dioxopiperidin-3-yl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80618531) has the molecular formula C8H7ClN4O3S and a molecular weight of 274.69 g/mol. Its IUPAC name is 5-chloro-N-(2,6-dioxopiperidin-3-yl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-(2,6-dioxopiperidin-3-yl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80618531 |
| Molecular Formula | C8H7ClN4O3S |
| Molecular Weight | 274.69 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 5-chloro-N-(2,6-dioxopiperidin-3-yl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2nnc(Cl)s2)C(=O)N1 |
| InChI | InChI=1S/C8H7ClN4O3S/c9-8-13-12-7(17-8)6(16)10-3-1-2-4(14)11-5(3)15/h3H,1-2H2,(H,10,16)(H,11,14,15) |
| InChIKey | RUQGKNYXPABGBZ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.69 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|